04-08-2021
Social Studies

contestada

What does NLU stands for?

Respuesta :

kanchanparki9 kanchanparki9

04-08-2021

Answer:

NLU stand for national Louis university.

Answer Link

Otras preguntas

The minute hand of a clock is 7 inches what distance does the tip of the minute hand move in 25 minutes

when you are citing an authors work only once, parenthetical documents should include

Productivity is _____. an economic measure of the amount of output (revenue, sales, profit) resulting from a measure of input (land, labor, capital) the abilit

Which branch of government would decide the value would be placed upon money? A.executive B.federal C.judicial D.legislative

which element of a short story tells the reader when and where the story takes place

Ronald spins a spinner that has 10 sections numbered from 1 to 10. What is the probability that the spinner lands on a 4

What’s the answer to this problem help please

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Thutmose i was the pharaoh who expelled the hyksos and restored egyptian confidence and reunification.

Which invention increased crop yields and made soil more porous ? A. The Sickle B. The Plow C. The Axe D. Chemical fertilizers