braunvan000 braunvan000

02-03-2022
History

contestada

Choose ALLl the correct answers.
The right to vote is an example of which of the following? Choose two.
civil right
individual right
collective right
political right

Respuesta :

alexharm390 alexharm390

02-03-2022

Answer:

Civil and Political Right

Explanation:

The right to vote is both a civil right, and a political right.

Answer Link

Otras preguntas

what were hercules twelve tasks?

Evaluate the piecewise function at the given values of the independent variable solver

If an angle is obtuse what type of angle is its supplement

Simplify the expression. 6t^3

URGENT PLEASE Find the equation of the line that passes through the point (-8,5) and is perpendicular to y=-4+2

how do scientists look for black holes in space

Historic Westminster Abbey in London, England, has been damaged by the sulfur dioxide and nitrogen oxide in acid rain. This is an example of _____. chemical we

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

What should u do if you see lightning while you are outside exercising

Fill in the blank: Do the boys buy the ticket? ¿ _____ los chicos el _____?